Sách chưa phân loại, sách kiến thức Ebook download miễn phí
Nội quy chuyên mục: - Hiện nay có khá nhiều trang chia sẻ Tài liệu nhưng mất phí, đó là lý do ket-noi mở ra chuyên mục Tài liệu miễn phí.

- Ai có tài liệu gì hay, hãy đăng lên đây để chia sẻ với mọi người nhé! Bạn chia sẻ hôm nay, ngày mai mọi người sẽ chia sẻ với bạn!
Cách chia sẻ, Upload tài liệu trên ket-noi

- Những bạn nào tích cực chia sẻ tài liệu, sẽ được ưu tiên cung cấp tài liệu khi có yêu cầu.
Nhận download tài liệu miễn phí
By minhphuong_1302
#673676

Download 18 Đề thi trắc nghiệm Hóa học có đáp án miễn phí





Câu 18. Tách nước từ rượu (CH3)2CHCH(OH)CH3 trong điều kiện thích hợp thu được anken.
Sản phẩm chính là
A. 2-metylbuten-1. B. 2-metylbuten-2. C. 3-metylbuten-1. D. penten-2.
Câu 19. Hai hiđrocacbon X, Y có cùng công thức phân tử C4H8. Khi phản ứng với brom, từ X thu được một dẫn xuất 1,2-đibrom-2-metylpropan; từ Y thu được hai dẫn xuất 1,3-đibrombutan và 1,3-đibrom-2-metylpropan. Tên gọi của X và Y tương ứng là
A. 2-metylpropen và buten-2. B. 2-metylpropen và metylxiclopropan.
C. buten-1 và buten-2. D. buten-2 và xiclobutan.
Câu 20. Cho hỗn hợp gồm không khí dư và hơi của 24 gam metanol đi qua chất xúc tác Cu nung nóng, sản phẩm thu được có thể tạo 40 ml fomalin 36% có d = 1,1 g/ml. Hiệu suất của quá trình trên là
A. 80,4%. B. 70,4%. C. 65,5%. D. 76,6%.
Câu 21. Cho các chất Đimetylamin (1), Metylamin (2), Amoniac (3), Anilin (4), p-metylanilin (5), p-nitroanilin (6). Tính bazơ tăng dần theo thứ tự là
A. (1), (2), (3), (4), (5), (6) B. (3), (2), (1), (4), (5), (6)
C. (6), (4), (5), (3), (2), (1) D. (6), (5), (4), (3), (2), (1)
Câu 22. Thuốc thử duy nhất có thể dùng để nhận biết 3 chất lỏng đựng trong 3 lọ mất nhãn: Phenol; Rượu Benzylic; Stiren là:
A. Na. B. Dung dịch NaOH. C. Quỳ tím. D. Dung dịch Br2.
 



Để DOWNLOAD tài liệu, xin trả lời bài viết này, mình sẽ upload tài liệu cho bạn ngay

Tóm tắt nội dung:

Câu 1. Trong tự nhiên oxi có ba đồng vị 16O, 17O, 18O; cacbon có hai đồng vị 12C, 13C. Hỏi có thể có bao nhiêu loại phân tử khí cacbonic tạo thành từ các đồng vị trên?
A. 6. B. 9. C. 12. D. 18.
Câu 2. Tổng số electron thuộc các phân lớp p trong nguyên tử của nguyên tố X là 15. Số điện tích hạt nhân của X bằng
A. 23. B. 29. C. 35. D. 33.
Câu 3. Cho các hạt vi mô: O2- (Z = 8); F - (Z = 9); Na, Na+ (Z = 11), Mg, Mg2+ (Z = 12), Al (Z = 13). Thứ tự giảm dần bán kính hạt là:
A. O2-, F -, Na, Na+, Mg, Mg2+, Al. B. Na, Mg, Al, Na+, Mg2+, O2-, F -
C. Na, Mg, Al, O2-, F - , Na+, Mg2+. D. Na+, Mg2+, O2-, F -, Na, Mg, Al.
Câu 4. Nguyên tử của nguyên tố X có cấu hình electron ở 2 phân lớp ngoài cùng là 3d24s2. Vị trí trong bảng tuần hoàn của X là:
A. chu kì 4, phân nhóm chính nhóm IV. B. chu kì 4, phân nhóm phụ nhóm IV.
C. chu kì 4, phân nhóm chính nhóm II. D. chu kì 4, phân nhóm phụ nhóm II.
Câu 5. Cho 7 gam hỗn hợp Cu, Fe (trong đó Fe chiếm 40% khối lượng) tác dụng với dd HNO3 loãng. Sau khi phản ứng xảy ra hoàn toàn, thu được khí NO (sản phẩm khử duy nhất), còn lại 4,6 gam kim loại không tan và dd X. Muối có trong dung dịch X là
A. Fe(NO3)3. B. Cu(NO3)2. C. Fe(NO3)3 và Cu(NO3)2. D. Fe(NO3)2.
Câu 6. Cho 5 gam brom có lẫn tạp chất là clo vào một dung dịch chứa 1,600 gam kali bromua. Sau phản ứng làm bay hơi dung dịch thì thu được 1,155 gam chất rắn khan. Phần trăm về khối lượng của clo trong mẫu brom đem phản ứng là
A. 5,1%. B. 6,1%. C. 7,1%. D. 8,1%.
Câu 7. Khi đun nóng muối kali clorat, không có xúc tác, muối này bị phân huỷ đồng thời theo hai hướng
(a) KClO3 → KCl + O2 và (b) KClO3 → KClO4 + KCl
Biết rằng phân huỷ hoàn toàn 7,35 gam KClO3 thu được 3,35 gam KCl. Phần trăm kali clorat bị phân huỷ theo (a) và (b) tương ứng là
A. 66,67% và 33,33%. B. 33,33% và 66,67%. C. 55,55% và 44,45%. D. 44,45% và 55,55% .
Câu 8. Cho 1,2 lít hỗn hợp gồm hiđro và clo vào bình thuỷ tinh đậy kín và chiếu sáng bằng ánh sáng khuếch tán. Sau một thời gian ngừng chiếu sáng thì thu được một hỗn hợp khí chứa 30% hiđroclorua về thể tích và hàm lượng của clo đã giảm xuống còn 20% so với lượng clo ban đầu. Thành phần phần trăm về thể tích của hiđro trong hỗn hợp ban đầu và trong hỗn hợp sau phản ứng lần lượt bằng
A. 66,25% và 18,75%. B. 81,25% và 66,25%. C. 66,25% và 30,75% D. 88,25% và 30,75%.
Câu 9. Một dung dịch có chứa H2SO4 và 0,543 gam muối natri của một axit chứa oxi của clo (muối X). Cho thêm vào dung dịch này một lượng KI cho đến khi iot ngừng sinh ra thì thu được 3,05 gam I2. Muối X là
A. NaClO4. B. NaClO3. C. NaClO2. D. NaClO.
Câu 10. Phản ứng giữa HNO3 với Fe3O4 tạo ra khí X (sản phẩm khử duy nhất) có tổng hệ số trong phương trình hoá học là 20 thì khí X là
A. N2. B. NO. C. NO2. D. N2O.
Câu 11. Cho 22 gam dd NaOH 10% vào 5 gam dd axit H3PO4 39,2%. Muối thu được sau phản ứng là
A. Na2HPO4. B. NaH2PO4. C. Na2HPO4 và NaH2PO4. D. Na3PO4 và Na2HPO4.
Câu 12. Dẫn từ từ khí NH3 đến dư vào dd ZnCl2. Hiện tượng quan sát được là
A. có kết tủa lục nhạt, không tan. B. có kết tủa trắng không tan.
C. có kết tủa xanh lam, không tan. D. có kết tủa trắng, sau đó tan ra.
Câu 13. Ankan X tác dụng với clo (askt) tạo ra dẫn xuất monoclo trong đó clo chiếm 55,04% về khối lượng. X có công thức phân tử là
A. CH4. B. C2H6. C. C3H8. D. C4H10.
Câu 14. Biết m gam một anken Y phản ứng được với tối đa 20m/7 gam Br2. Công thức phân tử của Y là
A.C2H4. B. C4H8. C. C3H6. D. C5H10.
Câu 15. Cho dung dịch chứa 1,22 gam chất hữu cơ X là đồng đẳng của phenol tác dụng với nước brom (dư) thu được 3,59 gam hợp chất Y chứa 3 nguyên tử brom trong phân tử (h = 100%). Công thức phân tử của X là
A. C7H8O. B. C8H10O. C. C9H12O. D. C10H14O.
Câu 16. Amin đơn chức X chứa 15,05% khối lượng nitơ. Tên X là
A. metylamin. B. etylamin. C. pentylamin. D. phenylamin.
Câu 17. Sắp xếp theo thứ tự tăng dần tính bazơ của các chất sau: (1) NH3, (2) CH3NH2, (3) C6H5NH2, (4) (CH3)2NH, (5) C2H5NH2, (6) p-O2N-C6H4NH2.
A. 6, 3, 1, 2, 5, 4. B. 3, 6, 1, 2, 4, 5. C. 4, 5, 2, 3, 1, 6. D. 1, 2, 3, 4, 5, 6.
Câu 18. Tách nước từ rượu (CH3)2CHCH(OH)CH3 trong điều kiện thích hợp thu được anken.
Sản phẩm chính là
A. 2-metylbuten-1. B. 2-metylbuten-2. C. 3-metylbuten-1. D. penten-2.
Câu 19. Hai hiđrocacbon X, Y có cùng công thức phân tử C4H8. Khi phản ứng với brom, từ X thu được một dẫn xuất 1,2-đibrom-2-metylpropan; từ Y thu được hai dẫn xuất 1,3-đibrombutan và 1,3-đibrom-2-metylpropan. Tên gọi của X và Y tương ứng là
A. 2-metylpropen và buten-2. B. 2-metylpropen và metylxiclopropan.
C. buten-1 và buten-2. D. buten-2 và xiclobutan.
Câu 20. Cho hỗn hợp gồm không khí dư và hơi của 24 gam metanol đi qua chất xúc tác Cu nung nóng, sản phẩm thu được có thể tạo 40 ml fomalin 36% có d = 1,1 g/ml. Hiệu suất của quá trình trên là
A. 80,4%. B. 70,4%. C. 65,5%. D. 76,6%.
Câu 21. Cho các chất Đimetylamin (1), Metylamin (2), Amoniac (3), Anilin (4), p-metylanilin (5), p-nitroanilin (6). Tính bazơ tăng dần theo thứ tự là
A. (1), (2), (3), (4), (5), (6) B. (3), (2), (1), (4), (5), (6)
C. (6), (4), (5), (3), (2), (1) D. (6), (5), (4), (3), (2), (1)
Câu 22. Thuốc thử duy nhất có thể dùng để nhận biết 3 chất lỏng đựng trong 3 lọ mất nhãn: Phenol; Rượu Benzylic; Stiren là:
A. Na. B. Dung dịch NaOH. C. Quỳ tím. D. Dung dịch Br2.
Câu 23. Để chứng tỏ muối C6H5NH3Cl có trong một bình đựng, ta cần dùng các hoá chất là
A. dung dịch Brôm. B. dung dịch NaOH và Br2.
C. dung dịch AgNO3, NaOH, Br2. D. dung dịch AgNO3, Br2
Câu 24. Sắp xếp theo thứ tự tăng dần nhiệt độ sôi của các chất sau: CH3OH(1), C2H5OH(2), CH3COOH(3), CH3COOC2H5(4), HCHO(5).
A. 5, 4, 1, 2, 3. B. 1, 2, 3, 4, 5. C. 5, 4, 3, 2, 1. D. 3, 2, 1, 5, 4.
Câu 25. Trong số các đồng phân là dẫn xuất của benzen có CTPT C8H10O, số đồng phân (X) thoả mãn điều kiện sau: (X) không phản ứng với NaOH và (X) (Y) polime. X là
A. 1. B. 3. C. 4. D. 2.
Câu 26. Một dung dịch chứa 1,22g chất hữu cơ X là đồng đẳng của phenol. Cho dung dịch trên tác dụng với nước brom (dư) thu được 3,59g hợp chất Y chứa 3 nguyên tử brom trong phân tử. Biết p/ư xảy ra với hiệu suất 100%. Công thức phân tử của X là
A. C7H8O. B. C8H10O. C. C9H12O. D. C10H14O.
Câu 27. Bốn este có công thưc phân tử: C3H4O2, C3H6O2, C4H6O2, C4H8O2. Công thức phân tử ứng với 2 este khi bị thuỷ phân cho ra hai chất hữu cơ đều có khả năng tham gia phản ứng tráng gương:
A. C3H4O2 và C4H8O2. B. C3H4O2 và C4H6O2. C. C3H4O2 và C3H6O2. D. C4H6O2 và C4H8O2.
Câu 28. Chia hỗn hợp X gồm hai axit đơn chức, kế tiếp nhau trong dãy đồng đẵng ra hai phần bằng nhau. Phần I phản ứng vừa đủ với 500 ml dung dịch NaOH 1M. Phần II phản ứng với lượng dư dung dịch Ag2O/NH3 tạo ra 43,2 gam Ag. Công thức cấu tạo và khối lượng của hai axit trong X là
A. 9,2 gam HCOOH và 18 gam CH3COOH.
B. 18 gam CH3COOH và 14,8 gam CH3CH2COOH.
C. 18,4 gam HCOOH và 36 gam CH3COOH.
D. 36 gam CH3COOH và 29,6 gam CH3CH2COOH.
Câu 29. Một chất béo có công thức: CH2(OCOC17H33)-CH(OCOC15H31)-CH2(OCOC17H29). Số mol H2 cần để hiđro hoá hoàn toàn 1 mol chất béo là
A. 1. B. 3. C. 4. D. 5.
Câu 30. Polivinyl axetat là polime được điều chế từ sản phẩm trùng hợp monome nào sau đây:
A. CH2=CH-COOCH3. B. CH2=CH-COOH.
C. CH2=CH-COOC2H5. D. CH2=CH-OCOCH3.
Câu 31. Trong số các polime sau: sợi bông (1); tơ tằm (2); len (3); tơ visco (4); tơ axetat (5);
Nilon-6,6 (6); tơ enang (7). Loại tơ có nguồn gốc từ xenlulozơ là
A. (1), (2), (3). B. (2), (3), (4) C. (1), (4), (5). D. (4), (6), (7).
Câu 32. Thuỷ phân một hợp chất gluxit Y theo phương t...
Kết nối đề xuất:
Thành ngữ tiếng Anh có chứa die
Advertisement
Advertisement